![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Dunlosky et al. - 20..> | 2020-11-27 17:11 | 1.6M | |
| 12-19 SingAlongWords..> | 2022-08-11 12:58 | 67K | |
| 130. PistackingRevie..> | 2022-08-11 12:58 | 360K | |
| 137. Peebles Conf. S..> | 2022-08-11 12:58 | 1.2M | |
| 138. Rhoden-Smith Ex..> | 2022-08-11 12:58 | 2.8M | |
| 140. Ikkanda DAN and..> | 2022-08-11 12:58 | 2.5M | |
| 148. Taft Kinase Mut..> | 2022-08-11 12:58 | 4.7M | |
| 219 Signature Course..> | 2022-08-11 12:58 | 1.0M | |
| 2ChiralCenters.docx | 2022-08-11 12:58 | 121K | |
| 2ChiralCenters.pdf | 2022-08-11 12:58 | 41K | |
| 3rd NMR handout.pdf | 2022-08-11 12:58 | 739K | |
| AlkaneNomenclature.doc | 2022-08-11 12:58 | 262K | |
| AlkaneNomenclature.pdf | 2022-08-11 12:58 | 60K | |
| Allsongs11-18.pdf | 2022-08-11 12:58 | 1.6M | |
| Allsongs12-19.pdf | 2022-08-11 12:58 | 1.5M | |
| AminoAcidspKa.pdf | 2022-08-11 12:58 | 63K | |
| Chiral drugs.pdf | 2022-08-11 12:58 | 6.5M | |
| Chpt 6-11 roadmap.pdf | 2022-08-11 12:58 | 396K | |
| Complete New To unde..> | 2022-08-11 12:58 | 4.6M | |
| CompletedRoadmap.pdf | 2022-08-11 12:58 | 86K | |
| CompleteRoadmap11-19..> | 2022-08-11 12:58 | 1.1M | |
| CorrectedClass Hando..> | 2022-08-11 12:58 | 58K | |
| Data Inquiry Flags a..> | 2022-08-11 12:58 | 4.1M | |
| Data Inquiry_Core Ho..> | 2022-08-11 12:58 | 2.5M | |
| DontStopBelieving co..> | 2022-08-11 12:58 | 62M | |
| eBookInformation2020..> | 2022-08-11 12:58 | 392K | |
| End of semester advi..> | 2022-08-11 12:58 | 140K | |
| gui_OWLv2-canvas-stu..> | 2022-08-11 12:58 | 874K | |
| Handoutsfl05/ | 2022-08-11 12:58 | - | |
| HybridOrbitalFigures..> | 2022-08-11 12:58 | 11M | |
| IppolitoScience2021 ..> | 2022-08-11 12:58 | 1.5M | |
| Last Class MessageGS..> | 2022-08-11 12:58 | 73M | |
| LectHand1.gif | 2022-08-11 12:58 | 27K | |
| LectHand2.gif | 2022-08-11 12:58 | 29K | |
| LectHand3.gif | 2022-08-11 12:58 | 26K | |
| Lecture5 handout.docx | 2022-08-11 12:58 | 1.0M | |
| LectureOverhead1.pdf | 2022-08-11 12:58 | 631K | |
| LectureOverhead2.pdf | 2022-08-11 12:58 | 884K | |
| LectureOverhead22.pdf | 2022-08-11 12:58 | 838K | |
| LectureOverhead3.pdf | 2022-08-11 12:58 | 714K | |
| LectureOverhead33.pdf | 2022-08-11 12:58 | 695K | |
| LextureOverhead1.pdf | 2022-08-11 12:58 | 656K | |
| LinusPosterIntroGS.mov | 2022-08-11 12:58 | 24M | |
| LoriHSAdviceVideo4-2..> | 2022-08-11 12:58 | 82M | |
| Mechanism Flowchart ..> | 2022-08-11 12:58 | 22K | |
| Mechanism Flowchart.cdx | 2022-08-11 12:58 | 8.1K | |
| Mechanism flowchart...> | 2022-08-11 12:58 | 241K | |
| Mechanism flowchart.pdf | 2022-08-11 12:58 | 31K | |
| Miles GS.mov | 2022-08-11 12:58 | 7.8M | |
| Mission, Vision, Val..> | 2022-08-11 12:58 | 139K | |
| More NMR Essentials...> | 2022-08-11 12:58 | 101K | |
| More NMR Essentials.pdf | 2022-08-11 12:58 | 208K | |
| mri-mach.jpg | 2022-08-11 12:58 | 12K | |
| Naming Alkenes.pdf | 2022-08-11 12:58 | 107K | |
| NMR web handout | 2022-08-11 12:58 | 29K | |
| NMR Graphics2.pdf | 2022-08-11 12:58 | 1.5M | |
| NMR special rules.docx | 2022-08-11 12:58 | 77K | |
| NMR special rules.pdf | 2022-08-11 12:58 | 35K | |
| NMR Structure TetraI..> | 2022-08-11 12:58 | 413K | |
| NMR Structure.pdf | 2022-08-11 12:58 | 413K | |
| NMRhandout.html | 2022-08-11 12:58 | 17K | |
| NMRhandout2.html | 2022-08-11 12:58 | 25K | |
| NMRhandout3.html | 2022-08-11 12:58 | 17K | |
| NMRmainpage.html | 2022-08-11 12:58 | 5.5K | |
| Nomenclature 1.cdx | 2022-08-11 12:58 | 9.4K | |
| Nomenclature2.cdx | 2022-08-11 12:58 | 7.2K | |
| NucleophilesTableSub..> | 2022-08-11 12:58 | 80K | |
| OmicronAnimation.mp4 | 2022-08-11 12:58 | 336M | |
| OmicronAnimationOld.mp4 | 2022-08-11 12:58 | 363M | |
| Program Review Final..> | 2022-08-11 12:58 | - | |
| RCSA Happy Holidays ..> | 2022-08-11 12:58 | 58M | |
| ReactionStudySheets/ | 2022-08-11 12:58 | - | |
| Roadmap Handouts 11-..> | 2022-08-11 12:58 | 1.1M | |
| Roadmap11-8-18.pdf | 2022-08-11 12:58 | 1.2M | |
| Roadmapfilledin.pdf | 2022-08-11 12:58 | 78K | |
| RoadmapTemplate11-2-..> | 2022-08-11 12:58 | 16K | |
| RoadmapTemplate4-3-0..> | 2022-08-11 12:58 | 33K | |
| RxnSummary09.doc | 2022-08-11 12:58 | 100K | |
| SN2Roadmap.pdf | 2022-08-11 12:58 | 32K | |
| SongsFromFl17.pdf | 2022-08-11 12:58 | 1.6M | |
| SPin splitting | 2022-08-11 12:58 | 24K | |
| Students Getting Sta..> | 2022-08-11 12:58 | 55K | |
| SubElimDecMap.cdx | 2022-08-11 12:58 | 1.2M | |
| SubElimDecMap.pdf | 2022-08-11 12:58 | 42K | |
| submitting_hw_guide.pdf | 2022-08-11 12:58 | 1.0M | |
| submitting_hw_guide[..> | 2022-08-11 12:58 | 1.0M | |
| Taft Kinase Mutation..> | 2022-08-11 12:58 | 4.7M | |
| The current COVID si..> | 2022-08-11 12:58 | 35K | |
| The current COVID si..> | 2022-08-11 12:58 | 264K | |
| The current COVID si..> | 2022-08-11 12:58 | 29K | |
| The current COVID si..> | 2022-08-11 12:58 | 241K | |
| To understand NMR.pdf | 2022-08-11 12:58 | 3.3M | |
| transparent.gif | 2022-08-11 12:58 | 43 | |
| UpisUp.jpg | 2022-08-11 12:58 | 296K | |
| UpisUp.pdf | 2022-08-11 12:58 | 313K | |
| UpisUp.psd | 2022-08-11 12:58 | 1.8M | |
| Using IA Bookshelf t..> | 2022-08-11 12:58 | 760K | |
| Using IA Bookshelf t..> | 2022-08-11 12:58 | 1.0M | |
| Wight JACS Mechanism..> | 2022-08-11 12:58 | 15M | |
| YESS 2.0 and TEV Den..> | 2022-08-11 12:58 | 3.0M | |
| 1940 Statement.pdf | 2022-08-12 12:29 | 143K | |
| First class.docx | 2022-08-15 08:39 | 18K | |
| First class.pdf | 2022-08-15 08:39 | 76K | |
| Dunlosky et al. - 20..> | 2022-08-16 09:06 | 1.6M | |
| Organic Chemistry I ..> | 2022-08-16 09:06 | 3.5M | |
| Hybridization2.docx | 2022-08-16 11:26 | 14M | |
| Hybridization.pdf | 2022-08-16 11:29 | 4.3M | |
| 146. Protease Substr..> | 2022-08-25 13:13 | 3.1M | |
| 136. YESS protease e..> | 2022-08-25 13:13 | 782K | |
| RxnSummary/ | 2022-11-21 21:32 | - | |
| Opioid receptor revi..> | 2022-11-30 11:09 | 109K | |
| ModernaVaccine.pdf | 2022-11-30 11:09 | 1.6M | |
| HIVMechanismDrugDesi..> | 2022-11-30 11:09 | 357K | |
| AIDS protease substr..> | 2022-11-30 11:09 | 496K | |
| FetanylBoundMuOpioid..> | 2022-11-30 12:50 | 11M | |