![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| AlkaneNomenGS.pdf | 2022-08-11 12:58 | 57K | |
| Alkane Nomenclature ..> | 2022-08-11 12:58 | 4.1K | |
| CarbonTable.gif | 2022-08-11 12:58 | 4.0K | |
| HXAdditionToAlkene.doc | 2022-08-11 12:58 | 57K | |
| How To Lewis Structu..> | 2022-08-11 12:58 | 14K | |
| How To Lewis Structu..> | 2022-08-11 12:58 | - | |
| MOLECULAR ORBITAL AN..> | 2022-08-11 12:58 | 100K | |
| MOLECULAR ORBITAL AN..> | 2022-08-11 12:58 | 163K | |
| MOVBHO.html | 2022-08-11 12:58 | 22K | |
| MOVBTheory.html | 2022-08-11 12:58 | 24K | |
| MOVBTheory.pdf | 2022-08-11 12:58 | 179K | |
| Nomen.gif | 2022-08-11 12:58 | 42K | |
| Nomen1.gif | 2022-08-11 12:58 | 27K | |
| Nomen2.gif | 2022-08-11 12:58 | 17K | |
| NomenGS.cdx | 2022-08-11 12:58 | 9.1K | |
| NomenHand.html | 2022-08-11 12:58 | 1.7K | |
| Nomenclature.pdf | 2022-08-11 12:58 | 73K | |
| Pibonds.html | 2022-08-11 12:58 | 3.2K | |
| QuanMech1.gif | 2022-08-11 12:58 | 3.4K | |
| QuantumMech2.gif | 2022-08-11 12:58 | 5.4K | |
| RSname copy.gif | 2022-08-11 12:58 | 24K | |
| Rxn Summary.gif | 2022-08-11 12:58 | 17K | |
| RxnSummary.html | 2022-08-11 12:58 | 1.2K | |
| Rxn Summary.pict | 2022-08-11 12:58 | 71K | |
| Sterohandpics.html | 2022-08-11 12:58 | 3.6K | |
| Sterohandpics1.html | 2022-08-11 12:58 | 3.2K | |
| Sterohandpics2.html | 2022-08-11 12:58 | 3.8K | |
| Sterohandpics3.html | 2022-08-11 12:58 | 3.1K | |
| Sterohanduc.htm | 2022-08-11 12:58 | 21K | |
| Sterohanduc_files/ | 2022-08-11 12:58 | - | |
| achiral copy.gif | 2022-08-11 12:58 | 9.8K | |
| alkaneNomenrules2 | 2022-08-11 12:58 | 4.3K | |
| endiachart copy.gif | 2022-08-11 12:58 | 40K | |
| pibonds1 copy.gif | 2022-08-11 12:58 | 13K | |
| stereohand.html | 2022-08-11 12:58 | 17K | |
| transparent.gif | 2022-08-11 12:58 | 43 | |
